ChemNet > CAS > 18781-31-2 2-Acetyl-3-methylbenzo[b]thiophene
18781-31-2 2-Acetyl-3-methylbenzo[b]thiophene
| Nama produk |
2-Acetyl-3-methylbenzo[b]thiophene |
| Nama bahasa Inggris |
2-Acetyl-3-methylbenzo[b]thiophene; 2-Acetyl-3-methylthianaphthene; 1-(3-Methylbenzo[b]thiophen-2-yl)ethan-1-one; 1-(3-methyl-1-benzothiophen-6-yl)ethanone; 1-(3-methyl-1-benzothiophen-2-yl)ethanone |
| MF |
C11H10OS |
| Berat Molekul |
190.2615 |
| InChI |
InChI=1/C11H10OS/c1-7-9-5-3-4-6-10(9)13-11(7)8(2)12/h3-6H,1-2H3 |
| CAS NO |
18781-31-2 |
| Struktur Molekul |
![18781-31-2 2-Acetyl-3-methylbenzo[b]thiophene](https://images-a.chemnet.com/suppliers/chembase/cas3/cas18781-31-2.gif)
|
| Kepadatan |
1.182g/cm3 |
| Titik lebur |
79℃ |
| Titik didih |
319.5°C at 760 mmHg |
| Indeks bias |
1.631 |
| Titik nyala |
147°C |
| Tekanan uap |
0.000337mmHg at 25°C |
| Simbol bahaya |
|
| Kode Risiko |
|
| Keselamatan Deskripsi |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
